C12H12N4O3S — CID 47172668
3-[3-(furan-2-yl)prop-2-enoylamino]-N-(1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 47172668) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)prop-2-enoylamino]-N-(1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[3-(furan-2-yl)prop-2-enoylamino]-N-(1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 47172668 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-[3-(furan-2-yl)prop-2-enoylamino]-N-(1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | O=C(C=Cc1ccco1)NCCC(=O)Nc1nncs1 |
| InChI | InChI=1S/C12H12N4O3S/c17-10(4-3-9-2-1-7-19-9)13-6-5-11(18)15-12-16-14-8-20-12/h1-4,7-8H,5-6H2,(H,13,17)(H,15,16,18) |
| InChIKey | JHUVXUMVUBJUPD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|