C11H10N4O3S — CID 47172737
3-(furan-2-yl)-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]prop-2-enamide (PubChem CID 47172737) has the molecular formula C11H10N4O3S and a molecular weight of 278.29 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 47172737 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)NCC(=O)Nc1nncs1 |
| InChI | InChI=1S/C11H10N4O3S/c16-9(4-3-8-2-1-5-18-8)12-6-10(17)14-11-15-13-7-19-11/h1-5,7H,6H2,(H,12,16)(H,14,15,17) |
| InChIKey | RRRAWVBJRIZCNM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|