C10H16N4O2S — CID 47173590
1-methyl-3-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]urea (PubChem CID 47173590) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-methyl-3-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-methyl-3-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 47173590 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-methyl-3-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]urea |
| SMILES | CNC(=O)Nc1nc(CN2CCOCC2)cs1 |
| InChI | InChI=1S/C10H16N4O2S/c1-11-9(15)13-10-12-8(7-17-10)6-14-2-4-16-5-3-14/h7H,2-6H2,1H3,(H2,11,12,13,15) |
| InChIKey | LAYVGSJGQDUMNV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |