About N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide
N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 47182407) has the molecular formula C11H12N4O3S
and a molecular weight of 280.31 g/mol. Its IUPAC name is N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 47182407 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CN(C(=O)Cn1ccc(=O)n(C)c1=O)c1nccs1 |
| InChI | InChI=1S/C11H12N4O3S/c1-13(10-12-4-6-19-10)9(17)7-15-5-3-8(16)14(2)11(15)18/h3-6H,7H2,1-2H3 |
| InChIKey | DBSCIVCIZIJARQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide (CID 47182407) is N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide is CN(C(=O)Cn1ccc(=O)n(C)c1=O)c1nccs1.
What is the InChIKey of N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is DBSCIVCIZIJARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3S/c1-13(10-12-4-6-19-10)9(17)7-15-5-3-8(16)14(2)11(15)18/h3-6H,7H2,1-2H3.
What are the key properties of N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide?
N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 280.31 g/mol, XLogP of -0.33, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 47182407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).