About 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide
2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide (PubChem CID 47185639) has the molecular formula C12H22N4O3S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide |
| PubChem CID | 47185639 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N(CC(N)=O)CC(C)C |
| InChI | InChI=1S/C12H22N4O3S/c1-8(2)6-16(7-11(13)17)20(18,19)12-9(3)14-15(5)10(12)4/h8H,6-7H2,1-5H3,(H2,13,17) |
| InChIKey | HJEDGHMUAIOLMX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide?
The IUPAC name of 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide (CID 47185639) is 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide.
What is the SMILES notation for 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide?
The canonical SMILES for 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide is Cc1nn(C)c(C)c1S(=O)(=O)N(CC(N)=O)CC(C)C.
What is the InChIKey of 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide?
The InChIKey is HJEDGHMUAIOLMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O3S/c1-8(2)6-16(7-11(13)17)20(18,19)12-9(3)14-15(5)10(12)4/h8H,6-7H2,1-5H3,(H2,13,17).
What are the key properties of 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide?
2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide has a molecular weight of 302.40 g/mol, XLogP of 0.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methylpropyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]acetamide is sourced from PubChem (CID 47185639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).