About 2-[(2,4-dimethoxyphenyl)methylamino]ethanol
2-[(2,4-dimethoxyphenyl)methylamino]ethanol (PubChem CID 4719059) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,4-dimethoxyphenyl)methylamino]ethanol |
| PubChem CID | 4719059 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methylamino]ethanol |
| SMILES | COc1ccc(CNCCO)c(OC)c1 |
| InChI | InChI=1S/C11H17NO3/c1-14-10-4-3-9(8-12-5-6-13)11(7-10)15-2/h3-4,7,12-13H,5-6,8H2,1-2H3 |
| InChIKey | KPLYXEDOBUIZRG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dimethoxyphenyl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dimethoxyphenyl)methylamino]ethanol?
The IUPAC name of 2-[(2,4-dimethoxyphenyl)methylamino]ethanol (CID 4719059) is 2-[(2,4-dimethoxyphenyl)methylamino]ethanol.
What is the SMILES notation for 2-[(2,4-dimethoxyphenyl)methylamino]ethanol?
The canonical SMILES for 2-[(2,4-dimethoxyphenyl)methylamino]ethanol is COc1ccc(CNCCO)c(OC)c1.
What is the InChIKey of 2-[(2,4-dimethoxyphenyl)methylamino]ethanol?
The InChIKey is KPLYXEDOBUIZRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-14-10-4-3-9(8-12-5-6-13)11(7-10)15-2/h3-4,7,12-13H,5-6,8H2,1-2H3.
What are the key properties of 2-[(2,4-dimethoxyphenyl)methylamino]ethanol?
2-[(2,4-dimethoxyphenyl)methylamino]ethanol has a molecular weight of 211.26 g/mol, XLogP of 0.79, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethoxyphenyl)methylamino]ethanol is sourced from PubChem (CID 4719059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).