C14H16ClFN2O — CID 47198534
1-(3-chloro-2-fluorophenyl)-3-(dicyclopropylmethyl)urea (PubChem CID 47198534) has the molecular formula C14H16ClFN2O and a molecular weight of 282.75 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-(dicyclopropylmethyl)urea.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-(dicyclopropylmethyl)urea |
|---|---|
| PubChem CID | 47198534 |
| Molecular Formula | C14H16ClFN2O |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-(dicyclopropylmethyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1F)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C14H16ClFN2O/c15-10-2-1-3-11(12(10)16)17-14(19)18-13(8-4-5-8)9-6-7-9/h1-3,8-9,13H,4-7H2,(H2,17,18,19) |
| InChIKey | QVLQXOFCPSUGCM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |