About 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea
1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (PubChem CID 47200101) has the molecular formula C11H14F3N3OS
and a molecular weight of 293.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| PubChem CID | 47200101 |
| Molecular Formula | C11H14F3N3OS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1nc(C(F)(F)F)cs1)NC1CCCCC1 |
| InChI | InChI=1S/C11H14F3N3OS/c12-11(13,14)8-6-19-10(16-8)17-9(18)15-7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,15,16,17,18) |
| InChIKey | MACKWKIBCGGWLB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
The IUPAC name of 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (CID 47200101) is 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
What is the SMILES notation for 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
The canonical SMILES for 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea is O=C(Nc1nc(C(F)(F)F)cs1)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
The InChIKey is MACKWKIBCGGWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3OS/c12-11(13,14)8-6-19-10(16-8)17-9(18)15-7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,15,16,17,18).
What are the key properties of 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea has a molecular weight of 293.31 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea is sourced from PubChem (CID 47200101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).