C10H15NO3S2 — CID 47207166
2-ethylsulfonyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 47207166) has the molecular formula C10H15NO3S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-ethylsulfonyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 47207166 |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-ethylsulfonyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CCS(=O)(=O)CC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C10H15NO3S2/c1-2-16(13,14)8-10(12)11-6-5-9-4-3-7-15-9/h3-4,7H,2,5-6,8H2,1H3,(H,11,12) |
| InChIKey | VDUNCHPUYZPUJD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |