C14H13Br2NOS — CID 47210807
5-bromo-N-[1-(4-bromophenyl)propan-2-yl]thiophene-2-carboxamide (PubChem CID 47210807) has the molecular formula C14H13Br2NOS and a molecular weight of 403.14 g/mol. Its IUPAC name is 5-bromo-N-[1-(4-bromophenyl)propan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(4-bromophenyl)propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47210807 |
| Molecular Formula | C14H13Br2NOS |
| Molecular Weight | 403.14 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | 5-bromo-N-[1-(4-bromophenyl)propan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(Cc1ccc(Br)cc1)NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H13Br2NOS/c1-9(8-10-2-4-11(15)5-3-10)17-14(18)12-6-7-13(16)19-12/h2-7,9H,8H2,1H3,(H,17,18) |
| InChIKey | IBJKYNBPAWSACU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |