C11H17N3O2 — CID 4721334
N',N'-dimethyl-N-[(4-nitrophenyl)methyl]ethane-1,2-diamine (PubChem CID 4721334) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(4-nitrophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(4-nitrophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 4721334 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N',N'-dimethyl-N-[(4-nitrophenyl)methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H17N3O2/c1-13(2)8-7-12-9-10-3-5-11(6-4-10)14(15)16/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | YOEVEYQQUXHSQY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|