C10H10N4O3 — CID 47215053
N,N-dimethyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 47215053) has the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. Its IUPAC name is N,N-dimethyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N,N-dimethyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 47215053 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N,N-dimethyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H10N4O3/c1-14(2)9(16)5-3-6-7(11-4-5)12-10(17)13-8(6)15/h3-4H,1-2H3,(H2,11,12,13,15,17) |
| InChIKey | FERWIXHFBMLXAL-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |