C9H15N3O2S — CID 47215825
5-[(dimethylsulfamoylamino)methyl]-2-methylpyridine (PubChem CID 47215825) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 5-[(dimethylsulfamoylamino)methyl]-2-methylpyridine.
| Compound Name | 5-[(dimethylsulfamoylamino)methyl]-2-methylpyridine |
|---|---|
| PubChem CID | 47215825 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5-[(dimethylsulfamoylamino)methyl]-2-methylpyridine |
| SMILES | Cc1ccc(CNS(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C9H15N3O2S/c1-8-4-5-9(6-10-8)7-11-15(13,14)12(2)3/h4-6,11H,7H2,1-3H3 |
| InChIKey | BCOATFLFWOOOTM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |