C14H22N2O2S — CID 47216645
1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 47216645) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47216645 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1cc(C(C)NC(=O)NCC2CCCO2)c(C)s1 |
| InChI | InChI=1S/C14H22N2O2S/c1-9-7-13(11(3)19-9)10(2)16-14(17)15-8-12-5-4-6-18-12/h7,10,12H,4-6,8H2,1-3H3,(H2,15,16,17) |
| InChIKey | NCKAAIWLZALJDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |