C24H27Cl2NO — CID 4721735
N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]adamantan-2-amine (PubChem CID 4721735) has the molecular formula C24H27Cl2NO and a molecular weight of 416.39 g/mol. Its IUPAC name is N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]adamantan-2-amine.
| Compound Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]adamantan-2-amine |
|---|---|
| PubChem CID | 4721735 |
| Molecular Formula | C24H27Cl2NO |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]adamantan-2-amine |
| SMILES | Clc1ccc(COc2cccc(CNC3C4CC5CC(C4)CC3C5)c2)c(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2NO/c25-21-5-4-18(23(26)12-21)14-28-22-3-1-2-15(11-22)13-27-24-19-7-16-6-17(9-19)10-20(24)8-16/h1-5,11-12,16-17,19-20,24,27H,6-10,13-14H2 |
| InChIKey | MIBCXUSGDVORLY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |