C19H27N — CID 4721832
N-benzyl-3,5-dimethyladamantan-1-amine (PubChem CID 4721832) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is N-benzyl-3,5-dimethyladamantan-1-amine.
| Compound Name | N-benzyl-3,5-dimethyladamantan-1-amine |
|---|---|
| PubChem CID | 4721832 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-benzyl-3,5-dimethyladamantan-1-amine |
| SMILES | CC12CC3CC(C)(C1)CC(NCc1ccccc1)(C3)C2 |
| InChI | InChI=1S/C19H27N/c1-17-8-16-9-18(2,12-17)14-19(10-16,13-17)20-11-15-6-4-3-5-7-15/h3-7,16,20H,8-14H2,1-2H3 |
| InChIKey | BBTIIMFGVUDAHP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |