About 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea (PubChem CID 47218838) has the molecular formula C11H21N5O
and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea.
Molecular Properties
| Compound Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea |
| PubChem CID | 47218838 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea |
| SMILES | CCn1cnnc1CNC(=O)NC(C)C(C)C |
| InChI | InChI=1S/C11H21N5O/c1-5-16-7-13-15-10(16)6-12-11(17)14-9(4)8(2)3/h7-9H,5-6H2,1-4H3,(H2,12,14,17) |
| InChIKey | IRZLDRBUPWEGTR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea?
The IUPAC name of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea (CID 47218838) is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea.
What is the SMILES notation for 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea?
The canonical SMILES for 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea is CCn1cnnc1CNC(=O)NC(C)C(C)C.
What is the InChIKey of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea?
The InChIKey is IRZLDRBUPWEGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5O/c1-5-16-7-13-15-10(16)6-12-11(17)14-9(4)8(2)3/h7-9H,5-6H2,1-4H3,(H2,12,14,17).
What are the key properties of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea?
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea has a molecular weight of 239.32 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylbutan-2-yl)urea is sourced from PubChem (CID 47218838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).