C13H11F2N3O2 — CID 47222176
N-[3-(difluoromethoxy)phenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 47222176) has the molecular formula C13H11F2N3O2 and a molecular weight of 279.25 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47222176 |
| Molecular Formula | C13H11F2N3O2 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2cccc(OC(F)F)c2)cn1 |
| InChI | InChI=1S/C13H11F2N3O2/c1-8-6-17-11(7-16-8)12(19)18-9-3-2-4-10(5-9)20-13(14)15/h2-7,13H,1H3,(H,18,19) |
| InChIKey | HATDVLOAJUNFGZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |