About 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide
4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 4722332) has the molecular formula C17H22N2O4S
and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide |
| PubChem CID | 4722332 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CNCCc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C17H22N2O4S/c1-22-16-8-5-14(11-17(16)23-2)12-19-10-9-13-3-6-15(7-4-13)24(18,20)21/h3-8,11,19H,9-10,12H2,1-2H3,(H2,18,20,21) |
| InChIKey | TZCPALNCOZRZIG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide?
The IUPAC name of 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide (CID 4722332) is 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide?
The canonical SMILES for 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide is COc1ccc(CNCCc2ccc(S(N)(=O)=O)cc2)cc1OC.
What is the InChIKey of 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide?
The InChIKey is TZCPALNCOZRZIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4S/c1-22-16-8-5-14(11-17(16)23-2)12-19-10-9-13-3-6-15(7-4-13)24(18,20)21/h3-8,11,19H,9-10,12H2,1-2H3,(H2,18,20,21).
What are the key properties of 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide?
4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide has a molecular weight of 350.44 g/mol, XLogP of 1.68, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide is sourced from PubChem (CID 4722332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).