About N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine
N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine (PubChem CID 4722400) has the molecular formula C11H15Cl2N
and a molecular weight of 232.15 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine |
| PubChem CID | 4722400 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N/c1-8(2)6-14-7-9-3-4-10(12)11(13)5-9/h3-5,8,14H,6-7H2,1-2H3 |
| InChIKey | RIXQXYSSUOUZBQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine?
The IUPAC name of N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine (CID 4722400) is N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine is CC(C)CNCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine?
The InChIKey is RIXQXYSSUOUZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2N/c1-8(2)6-14-7-9-3-4-10(12)11(13)5-9/h3-5,8,14H,6-7H2,1-2H3.
What are the key properties of N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine?
N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine has a molecular weight of 232.15 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)methyl]-2-methylpropan-1-amine is sourced from PubChem (CID 4722400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).