C9H10ClF3N2OS — CID 47228073
1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47228073) has the molecular formula C9H10ClF3N2OS and a molecular weight of 286.71 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47228073 |
| Molecular Formula | C9H10ClF3N2OS |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(NC(=O)NCC(F)(F)F)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H10ClF3N2OS/c1-5(6-2-3-7(10)17-6)15-8(16)14-4-9(11,12)13/h2-3,5H,4H2,1H3,(H2,14,15,16) |
| InChIKey | QOMOJVLLBAVXSZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |