C12H14N4O2 — CID 47228598
N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)furan-3-carboxamide (PubChem CID 47228598) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)furan-3-carboxamide.
| Compound Name | N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 47228598 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)furan-3-carboxamide |
| SMILES | O=C(NCc1nnc2n1CCCC2)c1ccoc1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(9-4-6-18-8-9)13-7-11-15-14-10-3-1-2-5-16(10)11/h4,6,8H,1-3,5,7H2,(H,13,17) |
| InChIKey | NLPTXDFCIOLRLR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |