About N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine
N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 4723679) has the molecular formula C21H18Cl2N2O
and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine.
Molecular Properties
| Compound Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine |
| PubChem CID | 4723679 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | Clc1cc(Cl)cc(-c2ccc(CNCCc3c[nH]c4ccccc34)o2)c1 |
| InChI | InChI=1S/C21H18Cl2N2O/c22-16-9-15(10-17(23)11-16)21-6-5-18(26-21)13-24-8-7-14-12-25-20-4-2-1-3-19(14)20/h1-6,9-12,24-25H,7-8,13H2 |
| InChIKey | WOPKUDWAWHMAHU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 40.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine?
The IUPAC name of N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine (CID 4723679) is N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine.
What is the SMILES notation for N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine?
The canonical SMILES for N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine is Clc1cc(Cl)cc(-c2ccc(CNCCc3c[nH]c4ccccc34)o2)c1.
What is the InChIKey of N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine?
The InChIKey is WOPKUDWAWHMAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2N2O/c22-16-9-15(10-17(23)11-16)21-6-5-18(26-21)13-24-8-7-14-12-25-20-4-2-1-3-19(14)20/h1-6,9-12,24-25H,7-8,13H2.
What are the key properties of N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine?
N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine has a molecular weight of 385.29 g/mol, XLogP of 6.07, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(1H-indol-3-yl)ethanamine is sourced from PubChem (CID 4723679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).