C17H23N3O2S — CID 4723880
4-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzenesulfonamide (PubChem CID 4723880) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 4-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4723880 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(CNCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-20(2)16-7-3-15(4-8-16)13-19-12-11-14-5-9-17(10-6-14)23(18,21)22/h3-10,19H,11-13H2,1-2H3,(H2,18,21,22) |
| InChIKey | GAFHFMSHSNKQDR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|