C11H15N5O2 — CID 47246051
4-[3-(pyrimidin-2-ylamino)propanoyl]piperazin-2-one (PubChem CID 47246051) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[3-(pyrimidin-2-ylamino)propanoyl]piperazin-2-one.
| Compound Name | 4-[3-(pyrimidin-2-ylamino)propanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 47246051 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-[3-(pyrimidin-2-ylamino)propanoyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)CCNc2ncccn2)CCN1 |
| InChI | InChI=1S/C11H15N5O2/c17-9-8-16(7-6-12-9)10(18)2-5-15-11-13-3-1-4-14-11/h1,3-4H,2,5-8H2,(H,12,17)(H,13,14,15) |
| InChIKey | BHKSJSQRTOJUOC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |