C16H25NO2S — CID 47248732
3-ethylsulfanyl-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)propanamide (PubChem CID 47248732) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)propanamide.
| Compound Name | 3-ethylsulfanyl-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)propanamide |
|---|---|
| PubChem CID | 47248732 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-ethylsulfanyl-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)propanamide |
| SMILES | CCSCCC(=O)NC1CC(C)(C)Cc2oc(C)cc21 |
| InChI | InChI=1S/C16H25NO2S/c1-5-20-7-6-15(18)17-13-9-16(3,4)10-14-12(13)8-11(2)19-14/h8,13H,5-7,9-10H2,1-4H3,(H,17,18) |
| InChIKey | RBHFOLVVWJHGGY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|