C11H12F3N3O3 — CID 47249058
2-[acetyl(methyl)amino]-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]acetamide (PubChem CID 47249058) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]acetamide.
| Compound Name | 2-[acetyl(methyl)amino]-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 47249058 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[acetyl(methyl)amino]-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]acetamide |
| SMILES | CC(=O)N(C)CC(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C11H12F3N3O3/c1-6(18)17(2)5-9(19)16-8-3-7(11(12,13)14)4-15-10(8)20/h3-4H,5H2,1-2H3,(H,15,20)(H,16,19) |
| InChIKey | FYHCQBNNSYFURO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |