C13H21NO4 — CID 47249813
N-(1,4-dioxaspiro[4.5]decan-8-yl)oxolane-2-carboxamide (PubChem CID 47249813) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)oxolane-2-carboxamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 47249813 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)oxolane-2-carboxamide |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)C1CCCO1 |
| InChI | InChI=1S/C13H21NO4/c15-12(11-2-1-7-16-11)14-10-3-5-13(6-4-10)17-8-9-18-13/h10-11H,1-9H2,(H,14,15) |
| InChIKey | RLWNDXMAXLDGJJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |