C14H14BrNO2S — CID 47250123
N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyphenyl)acetamide (PubChem CID 47250123) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 47250123 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H14BrNO2S/c1-18-13-5-3-2-4-10(13)6-14(17)16-8-12-7-11(15)9-19-12/h2-5,7,9H,6,8H2,1H3,(H,16,17) |
| InChIKey | TUJSNDJLDPFVNL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |