C16H20Cl2N2O — CID 4725311
N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 4725311) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.26 g/mol. Its IUPAC name is N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4725311 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C16H20Cl2N2O/c1-20(2)9-3-8-19-11-13-5-7-16(21-13)14-6-4-12(17)10-15(14)18/h4-7,10,19H,3,8-9,11H2,1-2H3 |
| InChIKey | REGGAOJEQONVIJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|