C13H10F3N3O — CID 47255196
2-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 47255196) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 47255196 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cc1nccc(C(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H10F3N3O/c1-8-17-6-5-11(18-8)12(20)19-10-4-2-3-9(7-10)13(14,15)16/h2-7H,1H3,(H,19,20) |
| InChIKey | DXKLZTMIOYNPIZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |