About 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine
3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine (PubChem CID 47259303) has the molecular formula C8H9F3N6S
and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
| PubChem CID | 47259303 |
| Molecular Formula | C8H9F3N6S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
| SMILES | Cn1ccnc1CSc1nnc(C(F)(F)F)n1N |
| InChI | InChI=1S/C8H9F3N6S/c1-16-3-2-13-5(16)4-18-7-15-14-6(17(7)12)8(9,10)11/h2-3H,4,12H2,1H3 |
| InChIKey | SISNSKCZIQAVGX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine (CID 47259303) is 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine is Cn1ccnc1CSc1nnc(C(F)(F)F)n1N.
What is the InChIKey of 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine?
The InChIKey is SISNSKCZIQAVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N6S/c1-16-3-2-13-5(16)4-18-7-15-14-6(17(7)12)8(9,10)11/h2-3H,4,12H2,1H3.
What are the key properties of 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine?
3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine has a molecular weight of 278.26 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methylimidazol-2-yl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 47259303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).