C12H14Cl2N4S — CID 4725976
4-[(2,3-dichlorophenyl)methylamino]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 4725976) has the molecular formula C12H14Cl2N4S and a molecular weight of 317.25 g/mol. Its IUPAC name is 4-[(2,3-dichlorophenyl)methylamino]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2,3-dichlorophenyl)methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4725976 |
| Molecular Formula | C12H14Cl2N4S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-[(2,3-dichlorophenyl)methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N4S/c1-2-4-10-16-17-12(19)18(10)15-7-8-5-3-6-9(13)11(8)14/h3,5-6,15H,2,4,7H2,1H3,(H,17,19) |
| InChIKey | CQJSPERKINPFTB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|