C10H14N4OS — CID 4725982
4-(furan-2-ylmethylamino)-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 4725982) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 4-(furan-2-ylmethylamino)-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(furan-2-ylmethylamino)-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4725982 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-(furan-2-ylmethylamino)-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1ccco1 |
| InChI | InChI=1S/C10H14N4OS/c1-2-4-9-12-13-10(16)14(9)11-7-8-5-3-6-15-8/h3,5-6,11H,2,4,7H2,1H3,(H,13,16) |
| InChIKey | YCZZMZFKYKNLBB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|