C7H9N3O3S2 — CID 47262490
N-(1,1-dioxothiolan-3-yl)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 47262490) has the molecular formula C7H9N3O3S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 47262490 |
| Molecular Formula | C7H9N3O3S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cnsn1 |
| InChI | InChI=1S/C7H9N3O3S2/c11-7(6-3-8-14-10-6)9-5-1-2-15(12,13)4-5/h3,5H,1-2,4H2,(H,9,11) |
| InChIKey | JUQFYVIMPUHEOH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |