About N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 47266064) has the molecular formula C12H12ClN3O2S2
and a molecular weight of 329.83 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 47266064 |
| Molecular Formula | C12H12ClN3O2S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NC1CCSc2ccc(Cl)cc21)c1cn[nH]c1 |
| InChI | InChI=1S/C12H12ClN3O2S2/c13-8-1-2-12-10(5-8)11(3-4-19-12)16-20(17,18)9-6-14-15-7-9/h1-2,5-7,11,16H,3-4H2,(H,14,15) |
| InChIKey | YYTVFHLLUAIGJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide (CID 47266064) is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide is O=S(=O)(NC1CCSc2ccc(Cl)cc21)c1cn[nH]c1.
What is the InChIKey of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide?
The InChIKey is YYTVFHLLUAIGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O2S2/c13-8-1-2-12-10(5-8)11(3-4-19-12)16-20(17,18)9-6-14-15-7-9/h1-2,5-7,11,16H,3-4H2,(H,14,15).
What are the key properties of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide?
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide has a molecular weight of 329.83 g/mol, XLogP of 2.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 47266064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).