C9H15N3O3S — CID 47267384
2,5-dimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine (PubChem CID 47267384) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2,5-dimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine.
| Compound Name | 2,5-dimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 47267384 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2,5-dimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine |
| SMILES | CC1CN(S(=O)(=O)c2cn[nH]c2)C(C)CO1 |
| InChI | InChI=1S/C9H15N3O3S/c1-7-6-15-8(2)5-12(7)16(13,14)9-3-10-11-4-9/h3-4,7-8H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | KKSAAJMRAAKKRR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |