C11H12ClN3O3S — CID 47267974
N-(5-chloro-2-ethoxyphenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 47267974) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.76 g/mol. Its IUPAC name is N-(5-chloro-2-ethoxyphenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(5-chloro-2-ethoxyphenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47267974 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(5-chloro-2-ethoxyphenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCOc1ccc(Cl)cc1NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C11H12ClN3O3S/c1-2-18-11-4-3-8(12)5-10(11)15-19(16,17)9-6-13-14-7-9/h3-7,15H,2H2,1H3,(H,13,14) |
| InChIKey | WLOGUTWBUJWVAZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |