C12H13Cl2N3O2S — CID 47268025
N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 47268025) has the molecular formula C12H13Cl2N3O2S and a molecular weight of 334.23 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47268025 |
| Molecular Formula | C12H13Cl2N3O2S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CC(c1ccc(Cl)cc1Cl)N(C)S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C12H13Cl2N3O2S/c1-8(11-4-3-9(13)5-12(11)14)17(2)20(18,19)10-6-15-16-7-10/h3-8H,1-2H3,(H,15,16) |
| InChIKey | KGAJDYJVIWZOLF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |