C11H18N4O3S — CID 47268138
N-ethyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 47268138) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-ethyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47268138 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-ethyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(S(=O)(=O)c2cn[nH]c2)CC1 |
| InChI | InChI=1S/C11H18N4O3S/c1-2-12-11(16)9-3-5-15(6-4-9)19(17,18)10-7-13-14-8-10/h7-9H,2-6H2,1H3,(H,12,16)(H,13,14) |
| InChIKey | MIABZJZQPFDPKJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |