About N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 47268140) has the molecular formula C10H14N4O3S
and a molecular weight of 270.31 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 47268140 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1CN(C)S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H14N4O3S/c1-7-10(8(2)17-13-7)6-14(3)18(15,16)9-4-11-12-5-9/h4-5H,6H2,1-3H3,(H,11,12) |
| InChIKey | UACKOIDNMPSZJZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide (CID 47268140) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide is Cc1noc(C)c1CN(C)S(=O)(=O)c1cn[nH]c1.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide?
The InChIKey is UACKOIDNMPSZJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O3S/c1-7-10(8(2)17-13-7)6-14(3)18(15,16)9-4-11-12-5-9/h4-5H,6H2,1-3H3,(H,11,12).
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide has a molecular weight of 270.31 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 47268140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).