About N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide
N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 47268215) has the molecular formula C9H14F3N3O2S
and a molecular weight of 285.29 g/mol. Its IUPAC name is N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 47268215 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCCCN(CC(F)(F)F)S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H14F3N3O2S/c1-2-3-4-15(7-9(10,11)12)18(16,17)8-5-13-14-6-8/h5-6H,2-4,7H2,1H3,(H,13,14) |
| InChIKey | RIOQWQWMBOYWKB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide (CID 47268215) is N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide is CCCCN(CC(F)(F)F)S(=O)(=O)c1cn[nH]c1.
What is the InChIKey of N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
The InChIKey is RIOQWQWMBOYWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3N3O2S/c1-2-3-4-15(7-9(10,11)12)18(16,17)8-5-13-14-6-8/h5-6H,2-4,7H2,1H3,(H,13,14).
What are the key properties of N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide has a molecular weight of 285.29 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 47268215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).