C16H17FN4OS — CID 4726902
4-[[5-(4-fluorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 4726902) has the molecular formula C16H17FN4OS and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[[5-(4-fluorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-(4-fluorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726902 |
| Molecular Formula | C16H17FN4OS |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-[[5-(4-fluorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H17FN4OS/c1-2-3-15-19-20-16(23)21(15)18-10-13-8-9-14(22-13)11-4-6-12(17)7-5-11/h4-9,18H,2-3,10H2,1H3,(H,20,23) |
| InChIKey | BHPPGYSBZYZVEA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|