C16H16Cl2N4OS — CID 4726916
4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 4726916) has the molecular formula C16H16Cl2N4OS and a molecular weight of 383.30 g/mol. Its IUPAC name is 4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726916 |
| Molecular Formula | C16H16Cl2N4OS |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C16H16Cl2N4OS/c1-2-3-15-20-21-16(24)22(15)19-9-11-5-7-14(23-11)12-8-10(17)4-6-13(12)18/h4-8,19H,2-3,9H2,1H3,(H,21,24) |
| InChIKey | LSYFXCRDVSRNRO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|