About (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone
(6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 4728180) has the molecular formula C15H25BrN2O
and a molecular weight of 329.28 g/mol. Its IUPAC name is (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 4728180 |
| Molecular Formula | C15H25BrN2O |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C23CCC(C)(C2Br)C3(C)C)CC1 |
| InChI | InChI=1S/C15H25BrN2O/c1-13(2)14(3)5-6-15(13,11(14)16)12(19)18-9-7-17(4)8-10-18/h11H,5-10H2,1-4H3 |
| InChIKey | QIXMMXMMSNHGNI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone (CID 4728180) is (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone is CN1CCN(C(=O)C23CCC(C)(C2Br)C3(C)C)CC1.
What is the InChIKey of (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone?
The InChIKey is QIXMMXMMSNHGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25BrN2O/c1-13(2)14(3)5-6-15(13,11(14)16)12(19)18-9-7-17(4)8-10-18/h11H,5-10H2,1-4H3.
What are the key properties of (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone?
(6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone has a molecular weight of 329.28 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl)-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 4728180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).