C17H18Cl3NO2 — CID 4728366
4,7,7-trimethyl-3-oxo-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4728366) has the molecular formula C17H18Cl3NO2 and a molecular weight of 374.70 g/mol. Its IUPAC name is 4,7,7-trimethyl-3-oxo-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 4,7,7-trimethyl-3-oxo-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4728366 |
| Molecular Formula | C17H18Cl3NO2 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4,7,7-trimethyl-3-oxo-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3cc(Cl)c(Cl)cc3Cl)(CC1=O)C2(C)C |
| InChI | InChI=1S/C17H18Cl3NO2/c1-15(2)16(3)4-5-17(15,8-13(16)22)14(23)21-12-7-10(19)9(18)6-11(12)20/h6-7H,4-5,8H2,1-3H3,(H,21,23) |
| InChIKey | HNEUMMUAXJVWIT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|