About N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide
N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4728637) has the molecular formula C20H29NO2
and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| PubChem CID | 4728637 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)C(=O)C2(C(=O)NC34CC5CC(CC(C5)C3)C4)CCC1C2 |
| InChI | InChI=1S/C20H29NO2/c1-18(2)15-3-4-20(11-15,16(18)22)17(23)21-19-8-12-5-13(9-19)7-14(6-12)10-19/h12-15H,3-11H2,1-2H3,(H,21,23) |
| InChIKey | ZSHVAPPFORAMSY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide?
The IUPAC name of N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (CID 4728637) is N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
What is the SMILES notation for N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide?
The canonical SMILES for N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is CC1(C)C(=O)C2(C(=O)NC34CC5CC(CC(C5)C3)C4)CCC1C2.
What is the InChIKey of N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide?
The InChIKey is ZSHVAPPFORAMSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2/c1-18(2)15-3-4-20(11-15,16(18)22)17(23)21-19-8-12-5-13(9-19)7-14(6-12)10-19/h12-15H,3-11H2,1-2H3,(H,21,23).
What are the key properties of N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide?
N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide has a molecular weight of 315.46 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is sourced from PubChem (CID 4728637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).