C19H23NO4 — CID 4728653
ethyl 4-[(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)amino]benzoate (PubChem CID 4728653) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 4-[(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 4728653 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl 4-[(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C23CCC(C2)C(C)(C)C3=O)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-4-24-15(21)12-5-7-14(8-6-12)20-17(23)19-10-9-13(11-19)18(2,3)16(19)22/h5-8,13H,4,9-11H2,1-3H3,(H,20,23) |
| InChIKey | HJAOYZJLDVUUMY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|