C16H17N2O3S- — CID 4728756
(15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanesulfonate (PubChem CID 4728756) has the molecular formula C16H17N2O3S- and a molecular weight of 317.39 g/mol. Its IUPAC name is (15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanesulfonate.
| Compound Name | (15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanesulfonate |
|---|---|
| PubChem CID | 4728756 |
| Molecular Formula | C16H17N2O3S- |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])c1nc3ccccc3nc12 |
| InChI | InChI=1S/C16H18N2O3S/c1-15(2)10-7-8-16(15,9-22(19,20)21)14-13(10)17-11-5-3-4-6-12(11)18-14/h3-6,10H,7-9H2,1-2H3,(H,19,20,21)/p-1 |
| InChIKey | BKXBPGLODGHXIS-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|