C14H13N3OS — CID 47288761
N-[(5-methylthiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide (PubChem CID 47288761) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 47288761 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc3nc[nH]c3c2)s1 |
| InChI | InChI=1S/C14H13N3OS/c1-9-2-4-11(19-9)7-15-14(18)10-3-5-12-13(6-10)17-8-16-12/h2-6,8H,7H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | IALDNFRQIPBXDA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |